C13H9NO2 — CID 118370842
15-methyl-8,11-dioxa-15-azatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14),12-hexaene (PubChem CID 118370842) has the molecular formula C13H9NO2 and a molecular weight of 211.22 g/mol. Its IUPAC name is 15-methyl-8,11-dioxa-15-azatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14),12-hexaene.
| Compound Name | 15-methyl-8,11-dioxa-15-azatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14),12-hexaene |
|---|---|
| PubChem CID | 118370842 |
| Molecular Formula | C13H9NO2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 15-methyl-8,11-dioxa-15-azatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14),12-hexaene |
| SMILES | Cn1c2ccoc2c2oc3ccccc3c21 |
| InChI | InChI=1S/C13H9NO2/c1-14-9-6-7-15-12(9)13-11(14)8-4-2-3-5-10(8)16-13/h2-7H,1H3 |
| InChIKey | NUZIGYAHWANZKO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 31.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |