C12H12N2O — CID 130322219
1,2-dimethyl-[1]benzofuro[3,2-b]pyrrol-3-amine (PubChem CID 130322219) has the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. Its IUPAC name is 1,2-dimethyl-[1]benzofuro[3,2-b]pyrrol-3-amine.
| Compound Name | 1,2-dimethyl-[1]benzofuro[3,2-b]pyrrol-3-amine |
|---|---|
| PubChem CID | 130322219 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 1,2-dimethyl-[1]benzofuro[3,2-b]pyrrol-3-amine |
| SMILES | Cc1c(N)c2oc3ccccc3c2n1C |
| InChI | InChI=1S/C12H12N2O/c1-7-10(13)12-11(14(7)2)8-5-3-4-6-9(8)15-12/h3-6H,13H2,1-2H3 |
| InChIKey | QMQKYNOLUHBSKI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 44.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |