C35H38N8O7S2 — CID 157488923
tert-butyl 4-[2-[6-(2-nitrophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]ethyl]piperazine-1-carboxylate;2-[6-(2-nitrophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]ethanol (PubChem CID 157488923) has the molecular formula C35H38N8O7S2 and a molecular weight of 746.87 g/mol. Its IUPAC name is tert-butyl 4-[2-[6-(2-nitrophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]ethyl]piperazine-1-carboxylate;2-[6-(2-nitrophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]ethanol.
| Compound Name | tert-butyl 4-[2-[6-(2-nitrophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]ethyl]piperazine-1-carboxylate;2-[6-(2-nitrophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 157488923 |
| Molecular Formula | C35H38N8O7S2 |
| Molecular Weight | 746.87 g/mol |
| Exact Mass | 746.23 |
| IUPAC Name | tert-butyl 4-[2-[6-(2-nitrophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]ethyl]piperazine-1-carboxylate;2-[6-(2-nitrophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]ethanol |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCc2csc3nc(-c4ccccc4[N+](=O)[O-])cn23)CC1.O=[N+]([O-])c1ccccc1-c1cn2c(CCO)csc2n1 |
| InChI | InChI=1S/C22H27N5O4S.C13H11N3O3S/c1-22(2,3)31-21(28)25-12-10-24(11-13-25)9-8-16-15-32-20-23-18(14-26(16)20)17-6-4-5-7-19(17)27(29)30;17-6-5-9-8-20-13-14-11(7-15(9)13)10-3-1-2-4-12(10)16(18)19/h4-7,14-15H,8-13H2,1-3H3;1-4,7-8,17H,5-6H2 |
| InChIKey | BXARSMCNIPEFCD-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 173.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.87 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|