C21H25N5O4S — CID 25232525
tert-butyl 4-[[6-(2-nitrophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]methyl]piperazine-1-carboxylate (PubChem CID 25232525) has the molecular formula C21H25N5O4S and a molecular weight of 443.53 g/mol. Its IUPAC name is tert-butyl 4-[[6-(2-nitrophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[6-(2-nitrophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 25232525 |
| Molecular Formula | C21H25N5O4S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | tert-butyl 4-[[6-(2-nitrophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2csc3nc(-c4ccccc4[N+](=O)[O-])cn23)CC1 |
| InChI | InChI=1S/C21H25N5O4S/c1-21(2,3)30-20(27)24-10-8-23(9-11-24)12-15-14-31-19-22-17(13-25(15)19)16-6-4-5-7-18(16)26(28)29/h4-7,13-14H,8-12H2,1-3H3 |
| InChIKey | OQUGCBNQUWSWMQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|