C23H33N5O2S — CID 143409782
tert-butyl 4-[[6-(2-aminophenyl)imidazo[2,1-b][1,3]thiazol-2-yl]methyl]piperazine-1-carboxylate;ethane (PubChem CID 143409782) has the molecular formula C23H33N5O2S and a molecular weight of 443.62 g/mol. Its IUPAC name is tert-butyl 4-[[6-(2-aminophenyl)imidazo[2,1-b][1,3]thiazol-2-yl]methyl]piperazine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-[[6-(2-aminophenyl)imidazo[2,1-b][1,3]thiazol-2-yl]methyl]piperazine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 143409782 |
| Molecular Formula | C23H33N5O2S |
| Molecular Weight | 443.62 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | tert-butyl 4-[[6-(2-aminophenyl)imidazo[2,1-b][1,3]thiazol-2-yl]methyl]piperazine-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CCN(Cc2cn3cc(-c4ccccc4N)nc3s2)CC1 |
| InChI | InChI=1S/C21H27N5O2S.C2H6/c1-21(2,3)28-20(27)25-10-8-24(9-11-25)12-15-13-26-14-18(23-19(26)29-15)16-6-4-5-7-17(16)22;1-2/h4-7,13-14H,8-12,22H2,1-3H3;1-2H3 |
| InChIKey | JDTMWHPMVIWLNI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.62 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|