C21H29N5O2S — CID 143408549
tert-butyl 4-[2-[5-(2-aminophenyl)-2-sulfanylidene-1H-imidazol-3-yl]prop-2-enyl]piperazine-1-carboxylate (PubChem CID 143408549) has the molecular formula C21H29N5O2S and a molecular weight of 415.56 g/mol. Its IUPAC name is tert-butyl 4-[2-[5-(2-aminophenyl)-2-sulfanylidene-1H-imidazol-3-yl]prop-2-enyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[5-(2-aminophenyl)-2-sulfanylidene-1H-imidazol-3-yl]prop-2-enyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 143408549 |
| Molecular Formula | C21H29N5O2S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | tert-butyl 4-[2-[5-(2-aminophenyl)-2-sulfanylidene-1H-imidazol-3-yl]prop-2-enyl]piperazine-1-carboxylate |
| SMILES | C=C(CN1CCN(C(=O)OC(C)(C)C)CC1)n1cc(-c2ccccc2N)[nH]c1=S |
| InChI | InChI=1S/C21H29N5O2S/c1-15(13-24-9-11-25(12-10-24)20(27)28-21(2,3)4)26-14-18(23-19(26)29)16-7-5-6-8-17(16)22/h5-8,14H,1,9-13,22H2,2-4H3,(H,23,29) |
| InChIKey | FCMUIGYTJLYEJW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|