C20H26N4O3S — CID 24965386
tert-butyl 4-[2-(5-phenyl-2-sulfanylidene-1H-imidazol-3-yl)acetyl]piperazine-1-carboxylate (PubChem CID 24965386) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is tert-butyl 4-[2-(5-phenyl-2-sulfanylidene-1H-imidazol-3-yl)acetyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(5-phenyl-2-sulfanylidene-1H-imidazol-3-yl)acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 24965386 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | tert-butyl 4-[2-(5-phenyl-2-sulfanylidene-1H-imidazol-3-yl)acetyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)Cn2cc(-c3ccccc3)[nH]c2=S)CC1 |
| InChI | InChI=1S/C20H26N4O3S/c1-20(2,3)27-19(26)23-11-9-22(10-12-23)17(25)14-24-13-16(21-18(24)28)15-7-5-4-6-8-15/h4-8,13H,9-12,14H2,1-3H3,(H,21,28) |
| InChIKey | BSRNCSDMHOBZIR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 70.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|