C15H19N3OS — CID 24965387
N,N-diethyl-2-(5-phenyl-2-sulfanylidene-1H-imidazol-3-yl)acetamide (PubChem CID 24965387) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is N,N-diethyl-2-(5-phenyl-2-sulfanylidene-1H-imidazol-3-yl)acetamide.
| Compound Name | N,N-diethyl-2-(5-phenyl-2-sulfanylidene-1H-imidazol-3-yl)acetamide |
|---|---|
| PubChem CID | 24965387 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | N,N-diethyl-2-(5-phenyl-2-sulfanylidene-1H-imidazol-3-yl)acetamide |
| SMILES | CCN(CC)C(=O)Cn1cc(-c2ccccc2)[nH]c1=S |
| InChI | InChI=1S/C15H19N3OS/c1-3-17(4-2)14(19)11-18-10-13(16-15(18)20)12-8-6-5-7-9-12/h5-10H,3-4,11H2,1-2H3,(H,16,20) |
| InChIKey | OTZSGCWVTCSPCR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|