C13H20ClF3Si — CID 157494936
3-chloropropyl-methyl-phenyl-(2,2,2-trifluoroethyl)silane;methane (PubChem CID 157494936) has the molecular formula C13H20ClF3Si and a molecular weight of 296.84 g/mol. Its IUPAC name is 3-chloropropyl-methyl-phenyl-(2,2,2-trifluoroethyl)silane;methane.
| Compound Name | 3-chloropropyl-methyl-phenyl-(2,2,2-trifluoroethyl)silane;methane |
|---|---|
| PubChem CID | 157494936 |
| Molecular Formula | C13H20ClF3Si |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 3-chloropropyl-methyl-phenyl-(2,2,2-trifluoroethyl)silane;methane |
| SMILES | C.C[Si](CCCCl)(CC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H16ClF3Si.CH4/c1-17(9-5-8-13,10-12(14,15)16)11-6-3-2-4-7-11;/h2-4,6-7H,5,8-10H2,1H3;1H4 |
| InChIKey | BXSDYPFMDSXVNN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|