C38H16F24FeN4P2 — CID 157499774
bis(bis[2,6-bis(trifluoromethyl)-3-pyridinyl]-cyclopenta-1,3-dien-1-ylphosphane);iron(2+) (PubChem CID 157499774) has the molecular formula C38H16F24FeN4P2 and a molecular weight of 1102.32 g/mol. Its IUPAC name is bis(bis[2,6-bis(trifluoromethyl)-3-pyridinyl]-cyclopenta-1,3-dien-1-ylphosphane);iron(2+).
| Compound Name | bis(bis[2,6-bis(trifluoromethyl)-3-pyridinyl]-cyclopenta-1,3-dien-1-ylphosphane);iron(2+) |
|---|---|
| PubChem CID | 157499774 |
| Molecular Formula | C38H16F24FeN4P2 |
| Molecular Weight | 1102.32 g/mol |
| Exact Mass | 1101.98 |
| IUPAC Name | bis(bis[2,6-bis(trifluoromethyl)-3-pyridinyl]-cyclopenta-1,3-dien-1-ylphosphane);iron(2+) |
| SMILES | FC(F)(F)c1ccc(P(c2ccc[cH-]2)c2ccc(C(F)(F)F)nc2C(F)(F)F)c(C(F)(F)F)n1.FC(F)(F)c1ccc(P(c2ccc[cH-]2)c2ccc(C(F)(F)F)nc2C(F)(F)F)c(C(F)(F)F)n1.[Fe+2] |
| InChI | InChI=1S/2C19H8F12N2P.Fe/c2*20-16(21,22)12-7-5-10(14(32-12)18(26,27)28)34(9-3-1-2-4-9)11-6-8-13(17(23,24)25)33-15(11)19(29,30)31;/h2*1-8H;/q2*-1;+2 |
| InChIKey | BYGQHJAMHSLYQM-UHFFFAOYSA-N |
| XLogP | 12.06 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1102.32 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|