C33H22F15O4P2+ — CID 157499978
[4-(1H-inden-1-yl)phenyl]-diphenylphosphanium;tris(1,1,2,2,2-pentafluoroethyl) phosphate (PubChem CID 157499978) has the molecular formula C33H22F15O4P2+ and a molecular weight of 829.45 g/mol. Its IUPAC name is [4-(1H-inden-1-yl)phenyl]-diphenylphosphanium;tris(1,1,2,2,2-pentafluoroethyl) phosphate.
| Compound Name | [4-(1H-inden-1-yl)phenyl]-diphenylphosphanium;tris(1,1,2,2,2-pentafluoroethyl) phosphate |
|---|---|
| PubChem CID | 157499978 |
| Molecular Formula | C33H22F15O4P2+ |
| Molecular Weight | 829.45 g/mol |
| Exact Mass | 829.07 |
| IUPAC Name | [4-(1H-inden-1-yl)phenyl]-diphenylphosphanium;tris(1,1,2,2,2-pentafluoroethyl) phosphate |
| SMILES | C1=CC(c2ccc([PH+](c3ccccc3)c3ccccc3)cc2)c2ccccc21.O=P(OC(F)(F)C(F)(F)F)(OC(F)(F)C(F)(F)F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C27H21P.C6F15O4P/c1-3-10-23(11-4-1)28(24-12-5-2-6-13-24)25-18-15-22(16-19-25)27-20-17-21-9-7-8-14-26(21)27;7-1(8,9)4(16,17)23-26(22,24-5(18,19)2(10,11)12)25-6(20,21)3(13,14)15/h1-20,27H;/p+1 |
| InChIKey | BYHFJKJQAPBPIA-UHFFFAOYSA-O |
| XLogP | 10.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.45 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|