C16H24O3 — CID 15751298
(1R,5R,6R,7S,11R)-7-(methoxymethoxy)-13-methyl-14-oxatetracyclo[9.2.1.01,5.06,11]tetradec-12-ene (PubChem CID 15751298) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is (1R,5R,6R,7S,11R)-7-(methoxymethoxy)-13-methyl-14-oxatetracyclo[9.2.1.01,5.06,11]tetradec-12-ene.
| Compound Name | (1R,5R,6R,7S,11R)-7-(methoxymethoxy)-13-methyl-14-oxatetracyclo[9.2.1.01,5.06,11]tetradec-12-ene |
|---|---|
| PubChem CID | 15751298 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (1R,5R,6R,7S,11R)-7-(methoxymethoxy)-13-methyl-14-oxatetracyclo[9.2.1.01,5.06,11]tetradec-12-ene |
| SMILES | COCO[C@H]1CCC[C@@]23C=C(C)[C@]4(CCC[C@@H]4[C@H]12)O3 |
| InChI | InChI=1S/C16H24O3/c1-11-9-15-7-4-6-13(18-10-17-2)14(15)12-5-3-8-16(11,12)19-15/h9,12-14H,3-8,10H2,1-2H3/t12-,13+,14-,15-,16+/m1/s1 |
| InChIKey | PLEGHZOLHSYMGB-JKJDWNRSSA-N |
| XLogP | 3.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|