C11H9N3OS — CID 15752390
4-(1,3-benzoxazol-2-ylmethyl)-1,3-thiazol-2-amine (PubChem CID 15752390) has the molecular formula C11H9N3OS and a molecular weight of 231.28 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-ylmethyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(1,3-benzoxazol-2-ylmethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 15752390 |
| Molecular Formula | C11H9N3OS |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 4-(1,3-benzoxazol-2-ylmethyl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(Cc2nc3ccccc3o2)cs1 |
| InChI | InChI=1S/C11H9N3OS/c12-11-13-7(6-16-11)5-10-14-8-3-1-2-4-9(8)15-10/h1-4,6H,5H2,(H2,12,13) |
| InChIKey | HQPNLBLNRUSEHI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |