C22H44NSn+ — CID 15760027
[(2S)-1,1-bis(prop-2-enyl)pyrrolidin-1-ium-2-yl]-tributylstannane (PubChem CID 15760027) has the molecular formula C22H44NSn+ and a molecular weight of 441.31 g/mol. Its IUPAC name is [(2S)-1,1-bis(prop-2-enyl)pyrrolidin-1-ium-2-yl]-tributylstannane.
| Compound Name | [(2S)-1,1-bis(prop-2-enyl)pyrrolidin-1-ium-2-yl]-tributylstannane |
|---|---|
| PubChem CID | 15760027 |
| Molecular Formula | C22H44NSn+ |
| Molecular Weight | 441.31 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | [(2S)-1,1-bis(prop-2-enyl)pyrrolidin-1-ium-2-yl]-tributylstannane |
| SMILES | C=CC[N+]1(CC=C)CCC[C@@H]1[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C10H17N.3C4H9.Sn/c1-3-7-11(8-4-2)9-5-6-10-11;3*1-3-4-2;/h3-4,9H,1-2,5-8,10H2;3*1,3-4H2,2H3;/q+1;;;; |
| InChIKey | LXHKDGNBXPPVRU-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.31 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|