C22H42O2Sn — CID 11070509
2-ethenyl-4-tributylstannyl-3,3a,4,5,6,7-hexahydro-2H-1-benzofuran-7a-ol (PubChem CID 11070509) has the molecular formula C22H42O2Sn and a molecular weight of 457.29 g/mol. Its IUPAC name is 2-ethenyl-4-tributylstannyl-3,3a,4,5,6,7-hexahydro-2H-1-benzofuran-7a-ol.
| Compound Name | 2-ethenyl-4-tributylstannyl-3,3a,4,5,6,7-hexahydro-2H-1-benzofuran-7a-ol |
|---|---|
| PubChem CID | 11070509 |
| Molecular Formula | C22H42O2Sn |
| Molecular Weight | 457.29 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 2-ethenyl-4-tributylstannyl-3,3a,4,5,6,7-hexahydro-2H-1-benzofuran-7a-ol |
| SMILES | C=CC1CC2C([Sn](CCCC)(CCCC)CCCC)CCCC2(O)O1 |
| InChI | InChI=1S/C10H15O2.3C4H9.Sn/c1-2-9-7-8-5-3-4-6-10(8,11)12-9;3*1-3-4-2;/h2,5,8-9,11H,1,3-4,6-7H2;3*1,3-4H2,2H3; |
| InChIKey | NQTKXEXMEPRVKD-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.29 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|