C16H34S2Sn — CID 12015330
tributyl-(2-deuterio-1,3-dithian-2-yl)stannane (PubChem CID 12015330) has the molecular formula C16H34S2Sn and a molecular weight of 410.30 g/mol. Its IUPAC name is tributyl-(2-deuterio-1,3-dithian-2-yl)stannane.
| Compound Name | tributyl-(2-deuterio-1,3-dithian-2-yl)stannane |
|---|---|
| PubChem CID | 12015330 |
| Molecular Formula | C16H34S2Sn |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | tributyl-(2-deuterio-1,3-dithian-2-yl)stannane |
| SMILES | [2H]C1([Sn](CCCC)(CCCC)CCCC)SCCCS1 |
| InChI | InChI=1S/C4H7S2.3C4H9.Sn/c1-2-5-4-6-3-1;3*1-3-4-2;/h4H,1-3H2;3*1,3-4H2,2H3;/i4D;;;; |
| InChIKey | MVAYCCARYJVKHY-ZIXQYCOMSA-N |
| XLogP | 6.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |