C14H28Sn — CID 177384784
tributyl(2-deuterio(1,2-14C2)ethynyl)stannane (PubChem CID 177384784) has the molecular formula C14H28Sn and a molecular weight of 320.08 g/mol. Its IUPAC name is tributyl(2-deuterio(1,2-14C2)ethynyl)stannane.
| Compound Name | tributyl(2-deuterio(1,2-14C2)ethynyl)stannane |
|---|---|
| PubChem CID | 177384784 |
| Molecular Formula | C14H28Sn |
| Molecular Weight | 320.08 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | tributyl(2-deuterio(1,2-14C2)ethynyl)stannane |
| SMILES | [2H][14C]#[14C][Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/3C4H9.C2H.Sn/c3*1-3-4-2;1-2;/h3*1,3-4H2,2H3;1H;/i;;;1+2D,2+2; |
| InChIKey | YEMJHNYABQHWHL-ROAYTNAVSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.08 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|