C7H9NS — CID 15770871
4,6-dimethyl-1H-pyridine-2-thione (PubChem CID 15770871) has the molecular formula C7H9NS and a molecular weight of 139.22 g/mol. Its IUPAC name is 4,6-dimethyl-1H-pyridine-2-thione.
| Compound Name | 4,6-dimethyl-1H-pyridine-2-thione |
|---|---|
| PubChem CID | 15770871 |
| Molecular Formula | C7H9NS |
| Molecular Weight | 139.22 g/mol |
| Exact Mass | 139.05 |
| IUPAC Name | 4,6-dimethyl-1H-pyridine-2-thione |
| SMILES | Cc1cc(C)[nH]c(=S)c1 |
| InChI | InChI=1S/C7H9NS/c1-5-3-6(2)8-7(9)4-5/h3-4H,1-2H3,(H,8,9) |
| InChIKey | ZVANSRULPRVUSG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.22 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|