C20H27NO5 — CID 15780234
tert-butyl 4-[(2-methylpropan-2-yl)oxy]-5-oxo-3-phenylmethoxy-2H-pyrrole-1-carboxylate (PubChem CID 15780234) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is tert-butyl 4-[(2-methylpropan-2-yl)oxy]-5-oxo-3-phenylmethoxy-2H-pyrrole-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-methylpropan-2-yl)oxy]-5-oxo-3-phenylmethoxy-2H-pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 15780234 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | tert-butyl 4-[(2-methylpropan-2-yl)oxy]-5-oxo-3-phenylmethoxy-2H-pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(OCc2ccccc2)=C(OC(C)(C)C)C1=O |
| InChI | InChI=1S/C20H27NO5/c1-19(2,3)25-16-15(24-13-14-10-8-7-9-11-14)12-21(17(16)22)18(23)26-20(4,5)6/h7-11H,12-13H2,1-6H3 |
| InChIKey | YSIQNXKGBAPSAG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |