C12H14N6O — CID 158000447
2,8-dimethyl-9-[(1-methylpyrazol-4-yl)methyl]-1H-purin-6-one (PubChem CID 158000447) has the molecular formula C12H14N6O and a molecular weight of 258.28 g/mol. Its IUPAC name is 2,8-dimethyl-9-[(1-methylpyrazol-4-yl)methyl]-1H-purin-6-one.
| Compound Name | 2,8-dimethyl-9-[(1-methylpyrazol-4-yl)methyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 158000447 |
| Molecular Formula | C12H14N6O |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 2,8-dimethyl-9-[(1-methylpyrazol-4-yl)methyl]-1H-purin-6-one |
| SMILES | Cc1nc2c(nc(C)n2Cc2cnn(C)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C12H14N6O/c1-7-14-11-10(12(19)15-7)16-8(2)18(11)6-9-4-13-17(3)5-9/h4-5H,6H2,1-3H3,(H,14,15,19) |
| InChIKey | BUKHPXLXBAINKR-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 81.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |