C37H69NO4 — CID 158001133
cyclododecanone;(2E)-cyclododec-2-en-1-ol;deuterioformamide;13-oxabicyclo[10.1.0]tridecane (PubChem CID 158001133) has the molecular formula C37H69NO4 and a molecular weight of 592.97 g/mol. Its IUPAC name is cyclododecanone;(2E)-cyclododec-2-en-1-ol;deuterioformamide;13-oxabicyclo[10.1.0]tridecane.
| Compound Name | cyclododecanone;(2E)-cyclododec-2-en-1-ol;deuterioformamide;13-oxabicyclo[10.1.0]tridecane |
|---|---|
| PubChem CID | 158001133 |
| Molecular Formula | C37H69NO4 |
| Molecular Weight | 592.97 g/mol |
| Exact Mass | 592.53 |
| IUPAC Name | cyclododecanone;(2E)-cyclododec-2-en-1-ol;deuterioformamide;13-oxabicyclo[10.1.0]tridecane |
| SMILES | C1CCCCCC2OC2CCCC1.O=C1CCCCCCCCCCC1.OC1/C=C/CCCCCCCCC1.[2H]C(N)=O |
| InChI | InChI=1S/3C12H22O.CH3NO/c1-2-4-6-8-10-12-11(13-12)9-7-5-3-1;2*13-12-10-8-6-4-2-1-3-5-7-9-11-12;2-1-3/h11-12H,1-10H2;1-11H2;8,10,12-13H,1-7,9,11H2;1H,(H2,2,3)/b;;10-8+;/i;;;1D |
| InChIKey | FDTCWZXUQCSPQU-FMIQTTNWSA-N |
| XLogP | 10.06 |
| TPSA | 92.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.97 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|