C14H24O3 — CID 177477275
(11S,12E)-11-hydroxy-1-oxacyclopentadec-12-en-2-one (PubChem CID 177477275) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (11S,12E)-11-hydroxy-1-oxacyclopentadec-12-en-2-one.
| Compound Name | (11S,12E)-11-hydroxy-1-oxacyclopentadec-12-en-2-one |
|---|---|
| PubChem CID | 177477275 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (11S,12E)-11-hydroxy-1-oxacyclopentadec-12-en-2-one |
| SMILES | O=C1CCCCCCCC[C@H](O)/C=C/CCO1 |
| InChI | InChI=1S/C14H24O3/c15-13-9-5-3-1-2-4-6-11-14(16)17-12-8-7-10-13/h7,10,13,15H,1-6,8-9,11-12H2/b10-7+/t13-/m0/s1 |
| InChIKey | TXGXVABSMGXMIT-RSPDNQDQSA-N |
| XLogP | 2.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|