C17H29N — CID 158002641
4,7-di(propan-2-yl)-3,5,6,7,8,9,10,10a-octahydrocycloocta[c]pyridine (PubChem CID 158002641) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is 4,7-di(propan-2-yl)-3,5,6,7,8,9,10,10a-octahydrocycloocta[c]pyridine.
| Compound Name | 4,7-di(propan-2-yl)-3,5,6,7,8,9,10,10a-octahydrocycloocta[c]pyridine |
|---|---|
| PubChem CID | 158002641 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | 4,7-di(propan-2-yl)-3,5,6,7,8,9,10,10a-octahydrocycloocta[c]pyridine |
| SMILES | CC(C)C1=C2CCC(C(C)C)CCCC2C=NC1 |
| InChI | InChI=1S/C17H29N/c1-12(2)14-6-5-7-15-10-18-11-17(13(3)4)16(15)9-8-14/h10,12-15H,5-9,11H2,1-4H3 |
| InChIKey | RUNHESHMUMDNGQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|