C10H22N2O6 — CID 158003972
tert-butyl N-hydroxycarbamate;tert-butyl(hydroxy)carbamic acid (PubChem CID 158003972) has the molecular formula C10H22N2O6 and a molecular weight of 266.29 g/mol. Its IUPAC name is tert-butyl N-hydroxycarbamate;tert-butyl(hydroxy)carbamic acid.
| Compound Name | tert-butyl N-hydroxycarbamate;tert-butyl(hydroxy)carbamic acid |
|---|---|
| PubChem CID | 158003972 |
| Molecular Formula | C10H22N2O6 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | tert-butyl N-hydroxycarbamate;tert-butyl(hydroxy)carbamic acid |
| SMILES | CC(C)(C)N(O)C(=O)O.CC(C)(C)OC(=O)NO |
| InChI | InChI=1S/2C5H11NO3/c1-5(2,3)9-4(7)6-8;1-5(2,3)6(9)4(7)8/h8H,1-3H3,(H,6,7);9H,1-3H3,(H,7,8) |
| InChIKey | FEBHPIMSAATNQM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|