C11H24N2O8 — CID 157057937
tert-butyl N-hydroxycarbamate;ethyl 2-hydroxyacetate;N-hydroxyacetamide (PubChem CID 157057937) has the molecular formula C11H24N2O8 and a molecular weight of 312.32 g/mol. Its IUPAC name is tert-butyl N-hydroxycarbamate;ethyl 2-hydroxyacetate;N-hydroxyacetamide.
| Compound Name | tert-butyl N-hydroxycarbamate;ethyl 2-hydroxyacetate;N-hydroxyacetamide |
|---|---|
| PubChem CID | 157057937 |
| Molecular Formula | C11H24N2O8 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | tert-butyl N-hydroxycarbamate;ethyl 2-hydroxyacetate;N-hydroxyacetamide |
| SMILES | CC(=O)NO.CC(C)(C)OC(=O)NO.CCOC(=O)CO |
| InChI | InChI=1S/C5H11NO3.C4H8O3.C2H5NO2/c1-5(2,3)9-4(7)6-8;1-2-7-4(6)3-5;1-2(4)3-5/h8H,1-3H3,(H,6,7);5H,2-3H2,1H3;5H,1H3,(H,3,4) |
| InChIKey | AAZBFORANNIPJA-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|