C12H11ClN4O3S — CID 158004161
2-chloro-5-methyl-N-(2-sulfamoyl-4-pyridinyl)pyridine-3-carboxamide (PubChem CID 158004161) has the molecular formula C12H11ClN4O3S and a molecular weight of 326.77 g/mol. Its IUPAC name is 2-chloro-5-methyl-N-(2-sulfamoyl-4-pyridinyl)pyridine-3-carboxamide.
| Compound Name | 2-chloro-5-methyl-N-(2-sulfamoyl-4-pyridinyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 158004161 |
| Molecular Formula | C12H11ClN4O3S |
| Molecular Weight | 326.77 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 2-chloro-5-methyl-N-(2-sulfamoyl-4-pyridinyl)pyridine-3-carboxamide |
| SMILES | Cc1cnc(Cl)c(C(=O)Nc2ccnc(S(N)(=O)=O)c2)c1 |
| InChI | InChI=1S/C12H11ClN4O3S/c1-7-4-9(11(13)16-6-7)12(18)17-8-2-3-15-10(5-8)21(14,19)20/h2-6H,1H3,(H2,14,19,20)(H,15,17,18) |
| InChIKey | FEBWVYSNWMPPCX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.77 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|