About bis(dihexylamino)methylidene-dimethylazanium;bis(trifluoromethanesulfonamide)
bis(dihexylamino)methylidene-dimethylazanium;bis(trifluoromethanesulfonamide) (PubChem CID 158005110) has the molecular formula C29H62F6N5O4S2+
and a molecular weight of 722.97 g/mol. Its IUPAC name is bis(dihexylamino)methylidene-dimethylazanium;bis(trifluoromethanesulfonamide).
Molecular Properties
| Compound Name | bis(dihexylamino)methylidene-dimethylazanium;bis(trifluoromethanesulfonamide) |
| PubChem CID | 158005110 |
| Molecular Formula | C29H62F6N5O4S2+ |
| Molecular Weight | 722.97 g/mol |
| Exact Mass | 722.41 |
| IUPAC Name | bis(dihexylamino)methylidene-dimethylazanium;bis(trifluoromethanesulfonamide) |
| SMILES | CCCCCCN(CCCCCC)C(N(CCCCCC)CCCCCC)=[N+](C)C.NS(=O)(=O)C(F)(F)F.NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C27H58N3.2CH2F3NO2S/c1-7-11-15-19-23-29(24-20-16-12-8-2)27(28(5)6)30(25-21-17-13-9-3)26-22-18-14-10-4;2*2-1(3,4)8(5,6)7/h7-26H2,1-6H3;2*(H2,5,6,7)/q+1;; |
| InChIKey | FEESKOXAZUKOOM-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 722.97 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze bis(dihexylamino)methylidene-dimethylazanium;bis(trifluoromethanesulfonamide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(dihexylamino)methylidene-dimethylazanium;bis(trifluoromethanesulfonamide)?
The IUPAC name of bis(dihexylamino)methylidene-dimethylazanium;bis(trifluoromethanesulfonamide) (CID 158005110) is bis(dihexylamino)methylidene-dimethylazanium;bis(trifluoromethanesulfonamide).
What is the SMILES notation for bis(dihexylamino)methylidene-dimethylazanium;bis(trifluoromethanesulfonamide)?
The canonical SMILES for bis(dihexylamino)methylidene-dimethylazanium;bis(trifluoromethanesulfonamide) is CCCCCCN(CCCCCC)C(N(CCCCCC)CCCCCC)=[N+](C)C.NS(=O)(=O)C(F)(F)F.NS(=O)(=O)C(F)(F)F.
What is the InChIKey of bis(dihexylamino)methylidene-dimethylazanium;bis(trifluoromethanesulfonamide)?
The InChIKey is FEESKOXAZUKOOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H58N3.2CH2F3NO2S/c1-7-11-15-19-23-29(24-20-16-12-8-2)27(28(5)6)30(25-21-17-13-9-3)26-22-18-14-10-4;2*2-1(3,4)8(5,6)7/h7-26H2,1-6H3;2*(H2,5,6,7)/q+1;;.
What are the key properties of bis(dihexylamino)methylidene-dimethylazanium;bis(trifluoromethanesulfonamide)?
bis(dihexylamino)methylidene-dimethylazanium;bis(trifluoromethanesulfonamide) has a molecular weight of 722.97 g/mol, XLogP of 7.13, 20 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(dihexylamino)methylidene-dimethylazanium;bis(trifluoromethanesulfonamide) is sourced from PubChem (CID 158005110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).