C26H29NO2 — CID 158011369
N-cyclopentyl-3-[2-[4-(2-methyl-4-oxopentyl)phenyl]ethynyl]benzamide (PubChem CID 158011369) has the molecular formula C26H29NO2 and a molecular weight of 387.52 g/mol. Its IUPAC name is N-cyclopentyl-3-[2-[4-(2-methyl-4-oxopentyl)phenyl]ethynyl]benzamide.
| Compound Name | N-cyclopentyl-3-[2-[4-(2-methyl-4-oxopentyl)phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 158011369 |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | N-cyclopentyl-3-[2-[4-(2-methyl-4-oxopentyl)phenyl]ethynyl]benzamide |
| SMILES | CC(=O)CC(C)Cc1ccc(C#Cc2cccc(C(=O)NC3CCCC3)c2)cc1 |
| InChI | InChI=1S/C26H29NO2/c1-19(16-20(2)28)17-23-14-11-21(12-15-23)10-13-22-6-5-7-24(18-22)26(29)27-25-8-3-4-9-25/h5-7,11-12,14-15,18-19,25H,3-4,8-9,16-17H2,1-2H3,(H,27,29) |
| InChIKey | FEXRDWZODUVZJU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|