C17H34O5Si — CID 158011549
6-O-tert-butyl 1-O-methyl 3-[tert-butyl(dimethyl)silyl]oxyhexanedioate (PubChem CID 158011549) has the molecular formula C17H34O5Si and a molecular weight of 346.54 g/mol. Its IUPAC name is 6-O-tert-butyl 1-O-methyl 3-[tert-butyl(dimethyl)silyl]oxyhexanedioate.
| Compound Name | 6-O-tert-butyl 1-O-methyl 3-[tert-butyl(dimethyl)silyl]oxyhexanedioate |
|---|---|
| PubChem CID | 158011549 |
| Molecular Formula | C17H34O5Si |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | 6-O-tert-butyl 1-O-methyl 3-[tert-butyl(dimethyl)silyl]oxyhexanedioate |
| SMILES | COC(=O)CC(CCC(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O5Si/c1-16(2,3)21-14(18)11-10-13(12-15(19)20-7)22-23(8,9)17(4,5)6/h13H,10-12H2,1-9H3 |
| InChIKey | VVKVNMNGXNEBOC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|