C20H40O5Si — CID 604412
[2-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-3-ethoxy-3-oxopropyl] hexanoate (PubChem CID 604412) has the molecular formula C20H40O5Si and a molecular weight of 388.62 g/mol. Its IUPAC name is [2-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-3-ethoxy-3-oxopropyl] hexanoate.
| Compound Name | [2-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-3-ethoxy-3-oxopropyl] hexanoate |
|---|---|
| PubChem CID | 604412 |
| Molecular Formula | C20H40O5Si |
| Molecular Weight | 388.62 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | [2-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-3-ethoxy-3-oxopropyl] hexanoate |
| SMILES | CCCCCC(=O)OCC(CO[Si](C)(C)C(C)(C)C(C)C)C(=O)OCC |
| InChI | InChI=1S/C20H40O5Si/c1-9-11-12-13-18(21)24-14-17(19(22)23-10-2)15-25-26(7,8)20(5,6)16(3)4/h16-17H,9-15H2,1-8H3 |
| InChIKey | MWIFBUMSDRFRJL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.62 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|