C18H38O3Si — CID 91866402
methyl (3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoate (PubChem CID 91866402) has the molecular formula C18H38O3Si and a molecular weight of 330.59 g/mol. Its IUPAC name is methyl (3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoate.
| Compound Name | methyl (3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoate |
|---|---|
| PubChem CID | 91866402 |
| Molecular Formula | C18H38O3Si |
| Molecular Weight | 330.59 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | methyl (3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoate |
| SMILES | COC(=O)C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)C(C)C |
| InChI | InChI=1S/C18H38O3Si/c1-12(2)16(9)17(11-18(19)20-10)21-22(13(3)4,14(5)6)15(7)8/h12-17H,11H2,1-10H3/t16-,17+/m1/s1 |
| InChIKey | MUHYABTZJWOQLE-SJORKVTESA-N |
| XLogP | 5.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.59 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|