About 6-oxohexyl 3-di(propan-2-yl)silyloxy-3-methylbutanoate
6-oxohexyl 3-di(propan-2-yl)silyloxy-3-methylbutanoate (PubChem CID 123799576) has the molecular formula C17H34O4Si
and a molecular weight of 330.54 g/mol. Its IUPAC name is 6-oxohexyl 3-di(propan-2-yl)silyloxy-3-methylbutanoate.
Molecular Properties
| Compound Name | 6-oxohexyl 3-di(propan-2-yl)silyloxy-3-methylbutanoate |
| PubChem CID | 123799576 |
| Molecular Formula | C17H34O4Si |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 6-oxohexyl 3-di(propan-2-yl)silyloxy-3-methylbutanoate |
| SMILES | CC(C)[SiH](OC(C)(C)CC(=O)OCCCCCC=O)C(C)C |
| InChI | InChI=1S/C17H34O4Si/c1-14(2)22(15(3)4)21-17(5,6)13-16(19)20-12-10-8-7-9-11-18/h11,14-15,22H,7-10,12-13H2,1-6H3 |
| InChIKey | AQHXVYQZCGERKC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6-oxohexyl 3-di(propan-2-yl)silyloxy-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxohexyl 3-di(propan-2-yl)silyloxy-3-methylbutanoate?
The IUPAC name of 6-oxohexyl 3-di(propan-2-yl)silyloxy-3-methylbutanoate (CID 123799576) is 6-oxohexyl 3-di(propan-2-yl)silyloxy-3-methylbutanoate.
What is the SMILES notation for 6-oxohexyl 3-di(propan-2-yl)silyloxy-3-methylbutanoate?
The canonical SMILES for 6-oxohexyl 3-di(propan-2-yl)silyloxy-3-methylbutanoate is CC(C)[SiH](OC(C)(C)CC(=O)OCCCCCC=O)C(C)C.
What is the InChIKey of 6-oxohexyl 3-di(propan-2-yl)silyloxy-3-methylbutanoate?
The InChIKey is AQHXVYQZCGERKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O4Si/c1-14(2)22(15(3)4)21-17(5,6)13-16(19)20-12-10-8-7-9-11-18/h11,14-15,22H,7-10,12-13H2,1-6H3.
What are the key properties of 6-oxohexyl 3-di(propan-2-yl)silyloxy-3-methylbutanoate?
6-oxohexyl 3-di(propan-2-yl)silyloxy-3-methylbutanoate has a molecular weight of 330.54 g/mol, XLogP of 4.02, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxohexyl 3-di(propan-2-yl)silyloxy-3-methylbutanoate is sourced from PubChem (CID 123799576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).