C62H61N9 — CID 158021490
9-[4-tert-butyl-3,5-bis[3-(4-methylphenyl)-2H-imidazol-1-yl]phenyl]-2,7-bis[3-(4-methylphenyl)-2H-imidazol-1-yl]carbazole (PubChem CID 158021490) has the molecular formula C62H61N9 and a molecular weight of 932.23 g/mol. Its IUPAC name is 9-[4-tert-butyl-3,5-bis[3-(4-methylphenyl)-2H-imidazol-1-yl]phenyl]-2,7-bis[3-(4-methylphenyl)-2H-imidazol-1-yl]carbazole.
| Compound Name | 9-[4-tert-butyl-3,5-bis[3-(4-methylphenyl)-2H-imidazol-1-yl]phenyl]-2,7-bis[3-(4-methylphenyl)-2H-imidazol-1-yl]carbazole |
|---|---|
| PubChem CID | 158021490 |
| Molecular Formula | C62H61N9 |
| Molecular Weight | 932.23 g/mol |
| Exact Mass | 931.50 |
| IUPAC Name | 9-[4-tert-butyl-3,5-bis[3-(4-methylphenyl)-2H-imidazol-1-yl]phenyl]-2,7-bis[3-(4-methylphenyl)-2H-imidazol-1-yl]carbazole |
| SMILES | Cc1ccc(N2C=CN(c3ccc4c5ccc(N6C=CN(c7ccc(C)cc7)C6)cc5n(-c5cc(N6C=CN(c7ccc(C)cc7)C6)c(C(C)(C)C)c(N6C=CN(c7ccc(C)cc7)C6)c5)c4c3)C2)cc1 |
| InChI | InChI=1S/C62H61N9/c1-44-8-16-48(17-9-44)63-28-30-67(40-63)52-24-26-55-56-27-25-53(68-31-29-64(41-68)49-18-10-45(2)11-19-49)37-58(56)71(57(55)36-52)54-38-59(69-34-32-65(42-69)50-20-12-46(3)13-21-50)61(62(5,6)7)60(39-54)70-35-33-66(43-70)51-22-14-47(4)15-23-51/h8-39H,40-43H2,1-7H3 |
| InChIKey | DOCWQQGLSZXUID-UHFFFAOYSA-N |
| XLogP | 14.34 |
| TPSA | 30.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 932.23 |
| LogP ≤ 5 | 14.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|