C27H26F3N9O6 — CID 158022526
6-fluoro-1-(2-methoxyethyl)indazol-4-amine;6-fluoro-1-(2-methoxyethyl)-4-nitroindazole;6-fluoro-4-nitro-1H-indazole (PubChem CID 158022526) has the molecular formula C27H26F3N9O6 and a molecular weight of 629.56 g/mol. Its IUPAC name is 6-fluoro-1-(2-methoxyethyl)indazol-4-amine;6-fluoro-1-(2-methoxyethyl)-4-nitroindazole;6-fluoro-4-nitro-1H-indazole.
| Compound Name | 6-fluoro-1-(2-methoxyethyl)indazol-4-amine;6-fluoro-1-(2-methoxyethyl)-4-nitroindazole;6-fluoro-4-nitro-1H-indazole |
|---|---|
| PubChem CID | 158022526 |
| Molecular Formula | C27H26F3N9O6 |
| Molecular Weight | 629.56 g/mol |
| Exact Mass | 629.20 |
| IUPAC Name | 6-fluoro-1-(2-methoxyethyl)indazol-4-amine;6-fluoro-1-(2-methoxyethyl)-4-nitroindazole;6-fluoro-4-nitro-1H-indazole |
| SMILES | COCCn1ncc2c(N)cc(F)cc21.COCCn1ncc2c([N+](=O)[O-])cc(F)cc21.O=[N+]([O-])c1cc(F)cc2[nH]ncc12 |
| InChI | InChI=1S/C10H10FN3O3.C10H12FN3O.C7H4FN3O2/c1-17-3-2-13-9-4-7(11)5-10(14(15)16)8(9)6-12-13;1-15-3-2-14-10-5-7(11)4-9(12)8(10)6-13-14;8-4-1-6-5(3-9-10-6)7(2-4)11(12)13/h4-6H,2-3H2,1H3;4-6H,2-3,12H2,1H3;1-3H,(H,9,10) |
| InChIKey | FGFMSZAECBGRHZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 195.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|