C25H30N6O6 — CID 157070738
2-methyloxane;4-nitro-1H-indazole;4-nitro-1-(oxan-2-yl)indazole (PubChem CID 157070738) has the molecular formula C25H30N6O6 and a molecular weight of 510.55 g/mol. Its IUPAC name is 2-methyloxane;4-nitro-1H-indazole;4-nitro-1-(oxan-2-yl)indazole.
| Compound Name | 2-methyloxane;4-nitro-1H-indazole;4-nitro-1-(oxan-2-yl)indazole |
|---|---|
| PubChem CID | 157070738 |
| Molecular Formula | C25H30N6O6 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | 2-methyloxane;4-nitro-1H-indazole;4-nitro-1-(oxan-2-yl)indazole |
| SMILES | CC1CCCCO1.O=[N+]([O-])c1cccc2[nH]ncc12.O=[N+]([O-])c1cccc2c1cnn2C1CCCCO1 |
| InChI | InChI=1S/C12H13N3O3.C7H5N3O2.C6H12O/c16-15(17)11-5-3-4-10-9(11)8-13-14(10)12-6-1-2-7-18-12;11-10(12)7-3-1-2-6-5(7)4-8-9-6;1-6-4-2-3-5-7-6/h3-5,8,12H,1-2,6-7H2;1-4H,(H,8,9);6H,2-5H2,1H3 |
| InChIKey | ACKAOZVDTSQMCZ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 151.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|