C34H54O7 — CID 158022987
2-(2-butoxyethoxy)ethanol;1-[2-(2-butoxyethoxy)ethoxy]prop-1-en-2-ylbenzene;2-phenylpropanal (PubChem CID 158022987) has the molecular formula C34H54O7 and a molecular weight of 574.80 g/mol. Its IUPAC name is 2-(2-butoxyethoxy)ethanol;1-[2-(2-butoxyethoxy)ethoxy]prop-1-en-2-ylbenzene;2-phenylpropanal.
| Compound Name | 2-(2-butoxyethoxy)ethanol;1-[2-(2-butoxyethoxy)ethoxy]prop-1-en-2-ylbenzene;2-phenylpropanal |
|---|---|
| PubChem CID | 158022987 |
| Molecular Formula | C34H54O7 |
| Molecular Weight | 574.80 g/mol |
| Exact Mass | 574.39 |
| IUPAC Name | 2-(2-butoxyethoxy)ethanol;1-[2-(2-butoxyethoxy)ethoxy]prop-1-en-2-ylbenzene;2-phenylpropanal |
| SMILES | CC(C=O)c1ccccc1.CCCCOCCOCCO.CCCCOCCOCCOC=C(C)c1ccccc1 |
| InChI | InChI=1S/C17H26O3.C9H10O.C8H18O3/c1-3-4-10-18-11-12-19-13-14-20-15-16(2)17-8-6-5-7-9-17;1-8(7-10)9-5-3-2-4-6-9;1-2-3-5-10-7-8-11-6-4-9/h5-9,15H,3-4,10-14H2,1-2H3;2-8H,1H3;9H,2-8H2,1H3 |
| InChIKey | FGGUPTRZFSBNAL-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.80 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|