C28H46O6 — CID 158088780
1,4-bis[1-[2-(2-butoxyethoxy)ethoxy]prop-1-en-2-yl]benzene (PubChem CID 158088780) has the molecular formula C28H46O6 and a molecular weight of 478.67 g/mol. Its IUPAC name is 1,4-bis[1-[2-(2-butoxyethoxy)ethoxy]prop-1-en-2-yl]benzene.
| Compound Name | 1,4-bis[1-[2-(2-butoxyethoxy)ethoxy]prop-1-en-2-yl]benzene |
|---|---|
| PubChem CID | 158088780 |
| Molecular Formula | C28H46O6 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | 1,4-bis[1-[2-(2-butoxyethoxy)ethoxy]prop-1-en-2-yl]benzene |
| SMILES | CCCCOCCOCCOC=C(C)c1ccc(C(C)=COCCOCCOCCCC)cc1 |
| InChI | InChI=1S/C28H46O6/c1-5-7-13-29-15-17-31-19-21-33-23-25(3)27-9-11-28(12-10-27)26(4)24-34-22-20-32-18-16-30-14-8-6-2/h9-12,23-24H,5-8,13-22H2,1-4H3 |
| InChIKey | IPBIREXAOAYXDA-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|