About 2-(1-carboxyethoxy-methyl-methylimino-λ5-phosphanyl)oxypropanoic acid;methane
2-(1-carboxyethoxy-methyl-methylimino-λ5-phosphanyl)oxypropanoic acid;methane (PubChem CID 158024033) has the molecular formula C10H24NO6P
and a molecular weight of 285.28 g/mol. Its IUPAC name is 2-(1-carboxyethoxy-methyl-methylimino-λ5-phosphanyl)oxypropanoic acid;methane.
Molecular Properties
| Compound Name | 2-(1-carboxyethoxy-methyl-methylimino-λ5-phosphanyl)oxypropanoic acid;methane |
| PubChem CID | 158024033 |
| Molecular Formula | C10H24NO6P |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 2-(1-carboxyethoxy-methyl-methylimino-λ5-phosphanyl)oxypropanoic acid;methane |
| SMILES | C.C.CN=P(C)(OC(C)C(=O)O)OC(C)C(=O)O |
| InChI | InChI=1S/C8H16NO6P.2CH4/c1-5(7(10)11)14-16(4,9-3)15-6(2)8(12)13;;/h5-6H,1-4H3,(H,10,11)(H,12,13);2*1H4 |
| InChIKey | FGKAGLZBFNRJHC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 105.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-carboxyethoxy-methyl-methylimino-λ5-phosphanyl)oxypropanoic acid;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-carboxyethoxy-methyl-methylimino-λ5-phosphanyl)oxypropanoic acid;methane?
The IUPAC name of 2-(1-carboxyethoxy-methyl-methylimino-λ5-phosphanyl)oxypropanoic acid;methane (CID 158024033) is 2-(1-carboxyethoxy-methyl-methylimino-λ5-phosphanyl)oxypropanoic acid;methane.
What is the SMILES notation for 2-(1-carboxyethoxy-methyl-methylimino-λ5-phosphanyl)oxypropanoic acid;methane?
The canonical SMILES for 2-(1-carboxyethoxy-methyl-methylimino-λ5-phosphanyl)oxypropanoic acid;methane is C.C.CN=P(C)(OC(C)C(=O)O)OC(C)C(=O)O.
What is the InChIKey of 2-(1-carboxyethoxy-methyl-methylimino-λ5-phosphanyl)oxypropanoic acid;methane?
The InChIKey is FGKAGLZBFNRJHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16NO6P.2CH4/c1-5(7(10)11)14-16(4,9-3)15-6(2)8(12)13;;/h5-6H,1-4H3,(H,10,11)(H,12,13);2*1H4.
What are the key properties of 2-(1-carboxyethoxy-methyl-methylimino-λ5-phosphanyl)oxypropanoic acid;methane?
2-(1-carboxyethoxy-methyl-methylimino-λ5-phosphanyl)oxypropanoic acid;methane has a molecular weight of 285.28 g/mol, XLogP of 2.53, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-carboxyethoxy-methyl-methylimino-λ5-phosphanyl)oxypropanoic acid;methane is sourced from PubChem (CID 158024033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).