C34H52N8O5 — CID 158030110
benzyl 5-[4-[4-[(7-amino-3-oxoheptyl)amino]-6-(8-amino-4-oxooctyl)-1,3,5-triazin-2-yl]piperazin-1-yl]-5-oxopentanoate (PubChem CID 158030110) has the molecular formula C34H52N8O5 and a molecular weight of 652.84 g/mol. Its IUPAC name is benzyl 5-[4-[4-[(7-amino-3-oxoheptyl)amino]-6-(8-amino-4-oxooctyl)-1,3,5-triazin-2-yl]piperazin-1-yl]-5-oxopentanoate.
| Compound Name | benzyl 5-[4-[4-[(7-amino-3-oxoheptyl)amino]-6-(8-amino-4-oxooctyl)-1,3,5-triazin-2-yl]piperazin-1-yl]-5-oxopentanoate |
|---|---|
| PubChem CID | 158030110 |
| Molecular Formula | C34H52N8O5 |
| Molecular Weight | 652.84 g/mol |
| Exact Mass | 652.41 |
| IUPAC Name | benzyl 5-[4-[4-[(7-amino-3-oxoheptyl)amino]-6-(8-amino-4-oxooctyl)-1,3,5-triazin-2-yl]piperazin-1-yl]-5-oxopentanoate |
| SMILES | NCCCCC(=O)CCCc1nc(NCCC(=O)CCCCN)nc(N2CCN(C(=O)CCCC(=O)OCc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C34H52N8O5/c35-19-6-4-12-28(43)14-8-15-30-38-33(37-21-18-29(44)13-5-7-20-36)40-34(39-30)42-24-22-41(23-25-42)31(45)16-9-17-32(46)47-26-27-10-2-1-3-11-27/h1-3,10-11H,4-9,12-26,35-36H2,(H,37,38,39,40) |
| InChIKey | OVFKTAXUDRUNQD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 186.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.84 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|