About 2-(7H-cyclopenta[b]pyridin-5-yl)-3,3-dimethyl-1,2-dihydroindole
2-(7H-cyclopenta[b]pyridin-5-yl)-3,3-dimethyl-1,2-dihydroindole (PubChem CID 158032130) has the molecular formula C18H18N2
and a molecular weight of 262.36 g/mol. Its IUPAC name is 2-(7H-cyclopenta[b]pyridin-5-yl)-3,3-dimethyl-1,2-dihydroindole.
Molecular Properties
| Compound Name | 2-(7H-cyclopenta[b]pyridin-5-yl)-3,3-dimethyl-1,2-dihydroindole |
| PubChem CID | 158032130 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 2-(7H-cyclopenta[b]pyridin-5-yl)-3,3-dimethyl-1,2-dihydroindole |
| SMILES | CC1(C)c2ccccc2NC1C1=CCc2ncccc21 |
| InChI | InChI=1S/C18H18N2/c1-18(2)14-7-3-4-8-16(14)20-17(18)13-9-10-15-12(13)6-5-11-19-15/h3-9,11,17,20H,10H2,1-2H3 |
| InChIKey | FQTUPSKBSJBWBQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(7H-cyclopenta[b]pyridin-5-yl)-3,3-dimethyl-1,2-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7H-cyclopenta[b]pyridin-5-yl)-3,3-dimethyl-1,2-dihydroindole?
The IUPAC name of 2-(7H-cyclopenta[b]pyridin-5-yl)-3,3-dimethyl-1,2-dihydroindole (CID 158032130) is 2-(7H-cyclopenta[b]pyridin-5-yl)-3,3-dimethyl-1,2-dihydroindole.
What is the SMILES notation for 2-(7H-cyclopenta[b]pyridin-5-yl)-3,3-dimethyl-1,2-dihydroindole?
The canonical SMILES for 2-(7H-cyclopenta[b]pyridin-5-yl)-3,3-dimethyl-1,2-dihydroindole is CC1(C)c2ccccc2NC1C1=CCc2ncccc21.
What is the InChIKey of 2-(7H-cyclopenta[b]pyridin-5-yl)-3,3-dimethyl-1,2-dihydroindole?
The InChIKey is FQTUPSKBSJBWBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2/c1-18(2)14-7-3-4-8-16(14)20-17(18)13-9-10-15-12(13)6-5-11-19-15/h3-9,11,17,20H,10H2,1-2H3.
What are the key properties of 2-(7H-cyclopenta[b]pyridin-5-yl)-3,3-dimethyl-1,2-dihydroindole?
2-(7H-cyclopenta[b]pyridin-5-yl)-3,3-dimethyl-1,2-dihydroindole has a molecular weight of 262.36 g/mol, XLogP of 3.79, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7H-cyclopenta[b]pyridin-5-yl)-3,3-dimethyl-1,2-dihydroindole is sourced from PubChem (CID 158032130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).