C11H14O4S — CID 158035626
5-[5-(2-hydroxyethyl)furan-2-yl]thiolane-3-carboxylic acid (PubChem CID 158035626) has the molecular formula C11H14O4S and a molecular weight of 242.30 g/mol. Its IUPAC name is 5-[5-(2-hydroxyethyl)furan-2-yl]thiolane-3-carboxylic acid.
| Compound Name | 5-[5-(2-hydroxyethyl)furan-2-yl]thiolane-3-carboxylic acid |
|---|---|
| PubChem CID | 158035626 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 5-[5-(2-hydroxyethyl)furan-2-yl]thiolane-3-carboxylic acid |
| SMILES | O=C(O)C1CSC(c2ccc(CCO)o2)C1 |
| InChI | InChI=1S/C11H14O4S/c12-4-3-8-1-2-9(15-8)10-5-7(6-16-10)11(13)14/h1-2,7,10,12H,3-6H2,(H,13,14) |
| InChIKey | OAWJWHGKRJAOGF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |