C8H10O3 — CID 153490794
2-[5-(2-hydroxyethyl)furan-2-yl]acetaldehyde (PubChem CID 153490794) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is 2-[5-(2-hydroxyethyl)furan-2-yl]acetaldehyde.
| Compound Name | 2-[5-(2-hydroxyethyl)furan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 153490794 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 2-[5-(2-hydroxyethyl)furan-2-yl]acetaldehyde |
| SMILES | O=CCc1ccc(CCO)o1 |
| InChI | InChI=1S/C8H10O3/c9-5-3-7-1-2-8(11-7)4-6-10/h1-2,5,10H,3-4,6H2 |
| InChIKey | HZDHIONPECPGJL-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|