About 6-azaspiro[3.4]octane-6-carboxylic acid;1-(3,3,3-trifluoropropyl)pyrrolidine
6-azaspiro[3.4]octane-6-carboxylic acid;1-(3,3,3-trifluoropropyl)pyrrolidine (PubChem CID 158036977) has the molecular formula C15H25F3N2O2
and a molecular weight of 322.37 g/mol. Its IUPAC name is 6-azaspiro[3.4]octane-6-carboxylic acid;1-(3,3,3-trifluoropropyl)pyrrolidine.
Molecular Properties
| Compound Name | 6-azaspiro[3.4]octane-6-carboxylic acid;1-(3,3,3-trifluoropropyl)pyrrolidine |
| PubChem CID | 158036977 |
| Molecular Formula | C15H25F3N2O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 6-azaspiro[3.4]octane-6-carboxylic acid;1-(3,3,3-trifluoropropyl)pyrrolidine |
| SMILES | FC(F)(F)CCN1CCCC1.O=C(O)N1CCC2(CCC2)C1 |
| InChI | InChI=1S/C8H13NO2.C7H12F3N/c10-7(11)9-5-4-8(6-9)2-1-3-8;8-7(9,10)3-6-11-4-1-2-5-11/h1-6H2,(H,10,11);1-6H2 |
| InChIKey | FHWGVPGQDUBMKC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-azaspiro[3.4]octane-6-carboxylic acid;1-(3,3,3-trifluoropropyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-azaspiro[3.4]octane-6-carboxylic acid;1-(3,3,3-trifluoropropyl)pyrrolidine?
The IUPAC name of 6-azaspiro[3.4]octane-6-carboxylic acid;1-(3,3,3-trifluoropropyl)pyrrolidine (CID 158036977) is 6-azaspiro[3.4]octane-6-carboxylic acid;1-(3,3,3-trifluoropropyl)pyrrolidine.
What is the SMILES notation for 6-azaspiro[3.4]octane-6-carboxylic acid;1-(3,3,3-trifluoropropyl)pyrrolidine?
The canonical SMILES for 6-azaspiro[3.4]octane-6-carboxylic acid;1-(3,3,3-trifluoropropyl)pyrrolidine is FC(F)(F)CCN1CCCC1.O=C(O)N1CCC2(CCC2)C1.
What is the InChIKey of 6-azaspiro[3.4]octane-6-carboxylic acid;1-(3,3,3-trifluoropropyl)pyrrolidine?
The InChIKey is FHWGVPGQDUBMKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2.C7H12F3N/c10-7(11)9-5-4-8(6-9)2-1-3-8;8-7(9,10)3-6-11-4-1-2-5-11/h1-6H2,(H,10,11);1-6H2.
What are the key properties of 6-azaspiro[3.4]octane-6-carboxylic acid;1-(3,3,3-trifluoropropyl)pyrrolidine?
6-azaspiro[3.4]octane-6-carboxylic acid;1-(3,3,3-trifluoropropyl)pyrrolidine has a molecular weight of 322.37 g/mol, XLogP of 3.58, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-azaspiro[3.4]octane-6-carboxylic acid;1-(3,3,3-trifluoropropyl)pyrrolidine is sourced from PubChem (CID 158036977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).