C10H18N2O2 — CID 68609636
2,9-diazaspiro[5.5]undecane-2-carboxylic acid (PubChem CID 68609636) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 2,9-diazaspiro[5.5]undecane-2-carboxylic acid.
| Compound Name | 2,9-diazaspiro[5.5]undecane-2-carboxylic acid |
|---|---|
| PubChem CID | 68609636 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 2,9-diazaspiro[5.5]undecane-2-carboxylic acid |
| SMILES | O=C(O)N1CCCC2(CCNCC2)C1 |
| InChI | InChI=1S/C10H18N2O2/c13-9(14)12-7-1-2-10(8-12)3-5-11-6-4-10/h11H,1-8H2,(H,13,14) |
| InChIKey | PMBGWLVXKQWQDQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |