2,9-diazaspiro[5.5]undecane-2-carboxylic acid

C10H18N2O2 — CID 68609636

IUPAC2,9-diazaspiro[5.5]undecane-2-carboxylic acid
SMILESO=C(O)N1CCCC2(CCNCC2)C1
InChIInChI=1S/C10H18N2O2/c13-9(14)12-7-1-2-10(8-12)3-5-11-6-4-10/h11H,1-8H2,(H,13,14)
InChIKeyPMBGWLVXKQWQDQ-UHFFFAOYSA-N
MW198.27 g/mol
LogP1.13
Rot. Bonds

About 2,9-diazaspiro[5.5]undecane-2-carboxylic acid

2,9-diazaspiro[5.5]undecane-2-carboxylic acid (PubChem CID 68609636) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 2,9-diazaspiro[5.5]undecane-2-carboxylic acid.

Molecular Properties

Compound Name2,9-diazaspiro[5.5]undecane-2-carboxylic acid
PubChem CID68609636
Molecular FormulaC10H18N2O2
Molecular Weight198.27 g/mol
Exact Mass198.14
IUPAC Name2,9-diazaspiro[5.5]undecane-2-carboxylic acid
SMILESO=C(O)N1CCCC2(CCNCC2)C1
InChIInChI=1S/C10H18N2O2/c13-9(14)12-7-1-2-10(8-12)3-5-11-6-4-10/h11H,1-8H2,(H,13,14)
InChIKeyPMBGWLVXKQWQDQ-UHFFFAOYSA-N
XLogP1.13
TPSA52.57 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.27
LogP ≤ 51.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2,9-diazaspiro[5.5]undecane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,9-diazaspiro[5.5]undecane-2-carboxylic acid?
The IUPAC name of 2,9-diazaspiro[5.5]undecane-2-carboxylic acid (CID 68609636) is 2,9-diazaspiro[5.5]undecane-2-carboxylic acid.
What is the SMILES notation for 2,9-diazaspiro[5.5]undecane-2-carboxylic acid?
The canonical SMILES for 2,9-diazaspiro[5.5]undecane-2-carboxylic acid is O=C(O)N1CCCC2(CCNCC2)C1.
What is the InChIKey of 2,9-diazaspiro[5.5]undecane-2-carboxylic acid?
The InChIKey is PMBGWLVXKQWQDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2/c13-9(14)12-7-1-2-10(8-12)3-5-11-6-4-10/h11H,1-8H2,(H,13,14).
What are the key properties of 2,9-diazaspiro[5.5]undecane-2-carboxylic acid?
2,9-diazaspiro[5.5]undecane-2-carboxylic acid has a molecular weight of 198.27 g/mol, XLogP of 1.13, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,9-diazaspiro[5.5]undecane-2-carboxylic acid is sourced from PubChem (CID 68609636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).