C27H35BBrIN2O2 — CID 158042094
3-bromo-2-iodopyridine;4-tert-butyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine;methane (PubChem CID 158042094) has the molecular formula C27H35BBrIN2O2 and a molecular weight of 637.21 g/mol. Its IUPAC name is 3-bromo-2-iodopyridine;4-tert-butyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine;methane.
| Compound Name | 3-bromo-2-iodopyridine;4-tert-butyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine;methane |
|---|---|
| PubChem CID | 158042094 |
| Molecular Formula | C27H35BBrIN2O2 |
| Molecular Weight | 637.21 g/mol |
| Exact Mass | 636.10 |
| IUPAC Name | 3-bromo-2-iodopyridine;4-tert-butyl-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine;methane |
| SMILES | Brc1cccnc1I.C.CC(C)(C)c1ccnc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)c1 |
| InChI | InChI=1S/C21H28BNO2.C5H3BrIN.CH4/c1-19(2,3)16-12-13-23-18(14-16)15-8-10-17(11-9-15)22-24-20(4,5)21(6,7)25-22;6-4-2-1-3-8-5(4)7;/h8-14H,1-7H3;1-3H;1H4 |
| InChIKey | FILZMIXZTURTAC-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.21 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|