About 2-methyl-2-[(Z)-prop-1-enyl]sulfonylpropane;2-methyl-2-[(E)-prop-1-enyl]sulfonylpropane
2-methyl-2-[(Z)-prop-1-enyl]sulfonylpropane;2-methyl-2-[(E)-prop-1-enyl]sulfonylpropane (PubChem CID 158046501) has the molecular formula C14H28O4S2
and a molecular weight of 324.51 g/mol. Its IUPAC name is 2-methyl-2-[(Z)-prop-1-enyl]sulfonylpropane;2-methyl-2-[(E)-prop-1-enyl]sulfonylpropane.
Molecular Properties
| Compound Name | 2-methyl-2-[(Z)-prop-1-enyl]sulfonylpropane;2-methyl-2-[(E)-prop-1-enyl]sulfonylpropane |
| PubChem CID | 158046501 |
| Molecular Formula | C14H28O4S2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2-methyl-2-[(Z)-prop-1-enyl]sulfonylpropane;2-methyl-2-[(E)-prop-1-enyl]sulfonylpropane |
| SMILES | C/C=C/S(=O)(=O)C(C)(C)C.C/C=C\S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/2C7H14O2S/c2*1-5-6-10(8,9)7(2,3)4/h2*5-6H,1-4H3/b6-5+;6-5- |
| InChIKey | FIYZATNUQRTJIC-JFFOEUGHSA-N |
| XLogP | 3.47 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-2-[(Z)-prop-1-enyl]sulfonylpropane;2-methyl-2-[(E)-prop-1-enyl]sulfonylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-[(Z)-prop-1-enyl]sulfonylpropane;2-methyl-2-[(E)-prop-1-enyl]sulfonylpropane?
The IUPAC name of 2-methyl-2-[(Z)-prop-1-enyl]sulfonylpropane;2-methyl-2-[(E)-prop-1-enyl]sulfonylpropane (CID 158046501) is 2-methyl-2-[(Z)-prop-1-enyl]sulfonylpropane;2-methyl-2-[(E)-prop-1-enyl]sulfonylpropane.
What is the SMILES notation for 2-methyl-2-[(Z)-prop-1-enyl]sulfonylpropane;2-methyl-2-[(E)-prop-1-enyl]sulfonylpropane?
The canonical SMILES for 2-methyl-2-[(Z)-prop-1-enyl]sulfonylpropane;2-methyl-2-[(E)-prop-1-enyl]sulfonylpropane is C/C=C/S(=O)(=O)C(C)(C)C.C/C=C\S(=O)(=O)C(C)(C)C.
What is the InChIKey of 2-methyl-2-[(Z)-prop-1-enyl]sulfonylpropane;2-methyl-2-[(E)-prop-1-enyl]sulfonylpropane?
The InChIKey is FIYZATNUQRTJIC-JFFOEUGHSA-N. The full InChI is InChI=1S/2C7H14O2S/c2*1-5-6-10(8,9)7(2,3)4/h2*5-6H,1-4H3/b6-5+;6-5-.
What are the key properties of 2-methyl-2-[(Z)-prop-1-enyl]sulfonylpropane;2-methyl-2-[(E)-prop-1-enyl]sulfonylpropane?
2-methyl-2-[(Z)-prop-1-enyl]sulfonylpropane;2-methyl-2-[(E)-prop-1-enyl]sulfonylpropane has a molecular weight of 324.51 g/mol, XLogP of 3.47, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-[(Z)-prop-1-enyl]sulfonylpropane;2-methyl-2-[(E)-prop-1-enyl]sulfonylpropane is sourced from PubChem (CID 158046501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).