C11H24O2S — CID 58548756
2-tert-butylsulfonyl-2,3,3-trimethylbutane (PubChem CID 58548756) has the molecular formula C11H24O2S and a molecular weight of 220.38 g/mol. Its IUPAC name is 2-tert-butylsulfonyl-2,3,3-trimethylbutane.
| Compound Name | 2-tert-butylsulfonyl-2,3,3-trimethylbutane |
|---|---|
| PubChem CID | 58548756 |
| Molecular Formula | C11H24O2S |
| Molecular Weight | 220.38 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 2-tert-butylsulfonyl-2,3,3-trimethylbutane |
| SMILES | CC(C)(C)C(C)(C)S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C11H24O2S/c1-9(2,3)11(7,8)14(12,13)10(4,5)6/h1-8H3 |
| InChIKey | NGURCAXTGUKHAF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |