C24H55NO4S2 — CID 165038422
2-tert-butylsulfinyl-2-methylpropane;2-tert-butylsulfonyl-2-methylpropane;N,N-ditert-butylhydroxylamine (PubChem CID 165038422) has the molecular formula C24H55NO4S2 and a molecular weight of 485.84 g/mol. Its IUPAC name is 2-tert-butylsulfinyl-2-methylpropane;2-tert-butylsulfonyl-2-methylpropane;N,N-ditert-butylhydroxylamine.
| Compound Name | 2-tert-butylsulfinyl-2-methylpropane;2-tert-butylsulfonyl-2-methylpropane;N,N-ditert-butylhydroxylamine |
|---|---|
| PubChem CID | 165038422 |
| Molecular Formula | C24H55NO4S2 |
| Molecular Weight | 485.84 g/mol |
| Exact Mass | 485.36 |
| IUPAC Name | 2-tert-butylsulfinyl-2-methylpropane;2-tert-butylsulfonyl-2-methylpropane;N,N-ditert-butylhydroxylamine |
| SMILES | CC(C)(C)N(O)C(C)(C)C.CC(C)(C)S(=O)(=O)C(C)(C)C.CC(C)(C)S(=O)C(C)(C)C |
| InChI | InChI=1S/C8H19NO.C8H18O2S.C8H18OS/c1-7(2,3)9(10)8(4,5)6;1-7(2,3)11(9,10)8(4,5)6;1-7(2,3)10(9)8(4,5)6/h10H,1-6H3;1-6H3;1-6H3 |
| InChIKey | NSYZUQQVEYLHCS-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.84 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|