C17H40O3S2 — CID 161376368
2-tert-butylsulfinyl-2-methylpropane;2-tert-butylsulfonyl-2-methylpropane;methane (PubChem CID 161376368) has the molecular formula C17H40O3S2 and a molecular weight of 356.64 g/mol. Its IUPAC name is 2-tert-butylsulfinyl-2-methylpropane;2-tert-butylsulfonyl-2-methylpropane;methane.
| Compound Name | 2-tert-butylsulfinyl-2-methylpropane;2-tert-butylsulfonyl-2-methylpropane;methane |
|---|---|
| PubChem CID | 161376368 |
| Molecular Formula | C17H40O3S2 |
| Molecular Weight | 356.64 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 2-tert-butylsulfinyl-2-methylpropane;2-tert-butylsulfonyl-2-methylpropane;methane |
| SMILES | C.CC(C)(C)S(=O)(=O)C(C)(C)C.CC(C)(C)S(=O)C(C)(C)C |
| InChI | InChI=1S/C8H18O2S.C8H18OS.CH4/c1-7(2,3)11(9,10)8(4,5)6;1-7(2,3)10(9)8(4,5)6;/h1-6H3;1-6H3;1H4 |
| InChIKey | VRDFBOMTGNGMGI-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.64 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |