C16H18F3N3O3 — CID 158047653
2-[1-(3-cyano-6-methyl-2-pyridinyl)piperidin-4-yl]acetic acid;2,2,2-trifluoroacetaldehyde (PubChem CID 158047653) has the molecular formula C16H18F3N3O3 and a molecular weight of 357.33 g/mol. Its IUPAC name is 2-[1-(3-cyano-6-methyl-2-pyridinyl)piperidin-4-yl]acetic acid;2,2,2-trifluoroacetaldehyde.
| Compound Name | 2-[1-(3-cyano-6-methyl-2-pyridinyl)piperidin-4-yl]acetic acid;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 158047653 |
| Molecular Formula | C16H18F3N3O3 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 2-[1-(3-cyano-6-methyl-2-pyridinyl)piperidin-4-yl]acetic acid;2,2,2-trifluoroacetaldehyde |
| SMILES | Cc1ccc(C#N)c(N2CCC(CC(=O)O)CC2)n1.O=CC(F)(F)F |
| InChI | InChI=1S/C14H17N3O2.C2HF3O/c1-10-2-3-12(9-15)14(16-10)17-6-4-11(5-7-17)8-13(18)19;3-2(4,5)1-6/h2-3,11H,4-8H2,1H3,(H,18,19);1H |
| InChIKey | FJCJISVDETZLAC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 94.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|